ChemNet > CAS > 151982-51-3 4-Bromo-2-fluorobenzoyl chloride
151982-51-3 4-Bromo-2-fluorobenzoyl chloride
| Nome del prodotto |
4-Bromo-2-fluorobenzoyl chloride |
| Sinonimi |
2-Fluoro-4-Bromobenzoyl Chloride |
| Formula molecolare |
C7H3BrClFO |
| Peso Molecolare |
237.4535 |
| InChI |
InChI=1/C7H3BrClFO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H |
| Numero CAS |
151982-51-3 |
| Struttura molecolare |
|
| Densità |
1.742g/cm3 |
| Punto di ebollizione |
236.9°C at 760 mmHg |
| Indice di rifrazione |
1.561 |
| Punto d'infiammabilità |
97.1°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
