ChemNet > CAS > 1731-79-9 dimethyl dodecanedioate
1731-79-9 dimethyl dodecanedioate
| Nome del prodotto |
dimethyl dodecanedioate |
| Sinonimi |
Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| Formula molecolare |
C14H26O4 |
| Peso Molecolare |
258.3538 |
| InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| Numero CAS |
1731-79-9 |
| EINECS |
217-050-6 |
| Struttura molecolare |
|
| Densità |
0.969g/cm3 |
| Punto di ebollizione |
300.9°C at 760 mmHg |
| Indice di rifrazione |
1.441 |
| Punto d'infiammabilità |
135°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
