1732-08-7 Dimethyl pimelate
Nome del prodotto |
Dimethyl pimelate |
Nome inglese |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
Formula molecolare |
C9H16O4 |
Peso Molecolare |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
Numero CAS |
1732-08-7 |
EINECS |
217-057-4 |
Struttura molecolare |
|
Densità |
1.022g/cm3 |
Punto di ebollizione |
250.3°C at 760 mmHg |
Indice di rifrazione |
1.427 |
Punto d'infiammabilità |
105.4°C |
Pressione di vapore |
0.0219mmHg at 25°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|