ChemNet > CAS > 175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
| Nome del prodotto |
(4-Methoxy-3-methylphenyl)boronic acid |
| Sinonimi |
4-Methoxy-3-methylphenylboronic acid; 4-Methoxy-3-methylbenzeneboronic acid |
| Formula molecolare |
C8H11BO3 |
| Peso Molecolare |
165.9821 |
| InChI |
InChI=1/C8H11BO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5,10-11H,1-2H3 |
| Numero CAS |
175883-62-2 |
| Struttura molecolare |
|
| Densità |
1.14g/cm3 |
| Punto di ebollizione |
321.4°C at 760 mmHg |
| Indice di rifrazione |
1.52 |
| Punto d'infiammabilità |
148.2°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
