1823-14-9 5-Phenyl-1-pentyne
Nome del prodotto |
5-Phenyl-1-pentyne |
Nome inglese |
5-Phenyl-1-pentyne; Pent-4-ynylbenzene; pent-4-yn-1-ylbenzene; (2S)-2-hydroxy-3-phenylpropanoic acid |
Formula molecolare |
C9H10O3 |
Peso Molecolare |
166.1739 |
InChI |
InChI=1/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 |
Numero CAS |
1823-14-9 |
EINECS |
217-352-8 |
Struttura molecolare |
|
Densità |
1.265g/cm3 |
Punto di ebollizione |
331.6°C at 760 mmHg |
Indice di rifrazione |
1.576 |
Punto d'infiammabilità |
168.5°C |
Pressione di vapore |
6.17E-05mmHg at 25°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|