ChemNet > CAS > 189331-47-3 5-bromo-4-metiltiofene-2-carbaldoide
189331-47-3 5-bromo-4-metiltiofene-2-carbaldoide
| Nome del prodotto |
5-bromo-4-metiltiofene-2-carbaldoide |
| Sinonimi |
2-tiofenecarbaldoide, 5-bromo-4-metil-; 2-tiofenecarbossaldeide, 5-bromo-4-metil-; 5-bromo-4-metil-2-tiofenecarbaldoide; 5-bromo-4-metil-2-tiofenecarbossaldeide; 5-bromo-4-metiltiofene-2-carbossaldeide; T5SJ BE C1 EVH [WLN] |
| Nome inglese |
5-bromo-4-methylthiophene-2-carbaldehyde; 2-Thiophenecarbaldehyde, 5-bromo-4-methyl-; 2-Thiophenecarboxaldehyde, 5-bromo-4-methyl-; 5-Bromo-4-methyl-2-thiophenecarbaldehyde; 5-Bromo-4-methyl-2-thiophenecarboxaldehyde; 5-Bromo-4-methylthiophene-2-carboxaldehyde; T5SJ BE C1 EVH [WLN] |
| Formula molecolare |
C6H5BrOS |
| Peso Molecolare |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c1-4-2-5(3-8)9-6(4)7/h2-3H,1H3 |
| Numero CAS |
189331-47-3 |
| Struttura molecolare |
|
| Densità |
1.667g/cm3 |
| Punto di ebollizione |
264.996°C at 760 mmHg |
| Indice di rifrazione |
1.632 |
| Punto d'infiammabilità |
114.066°C |
| Pressione di vapore |
0.009mmHg at 25°C |
|