ChemNet > CAS > 213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
| Nome del prodotto |
(S)-2-Isobutylsuccinic acid-1-methyl ester |
| Sinonimi |
(S)-3-Methoxycarbonyl-5-methylhexanoic acid; (S)-(-)-2-Isobutylsuccinic acid 1-methyl ester; (3S)-3-(methoxycarbonyl)-5-methylhexanoic acid; (3S)-3-(methoxycarbonyl)-5-methylhexanoate; 3-(methoxycarbonyl)-5-methylhexanoic acid |
| Formula molecolare |
C9H16O4 |
| Peso Molecolare |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-6(2)4-7(5-8(10)11)9(12)13-3/h6-7H,4-5H2,1-3H3,(H,10,11) |
| Numero CAS |
213270-36-1 |
| Struttura molecolare |
|
| Densità |
1.07g/cm3 |
| Punto di ebollizione |
288.632°C at 760 mmHg |
| Indice di rifrazione |
1.447 |
| Punto d'infiammabilità |
107.989°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
