ChemNet > CAS > 216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
216393-64-5 4-Bromo-2-fluorobenzeneboronic acid
| Nome del prodotto |
4-Bromo-2-fluorobenzeneboronic acid |
| Sinonimi |
4-Bromo-2-fluorophenylboronic acid |
| Formula molecolare |
C6H5BBrFO2 |
| Peso Molecolare |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
| Numero CAS |
216393-64-5 |
| Struttura molecolare |
|
| Densità |
1.75g/cm3 |
| Punto di ebollizione |
310.6°C at 760 mmHg |
| Indice di rifrazione |
1.571 |
| Punto d'infiammabilità |
141.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
