ChemNet > CAS > 2210-28-8 n-Propyl methacrylate
2210-28-8 n-Propyl methacrylate
| Nome del prodotto |
n-Propyl methacrylate |
| Sinonimi |
n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| Formula molecolare |
C7H12O2 |
| Peso Molecolare |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| Numero CAS |
2210-28-8 |
| EINECS |
218-639-0 |
| Struttura molecolare |
|
| Densit脿 |
0.899g/cm3 |
| Punto di ebollizione |
141掳C at 760 mmHg |
| Indice di rifrazione |
1.416 |
| Punto d'infiammabilit脿 |
34.7掳C |
| Simboli di pericolo |
|
| Codici di Rischio |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
