ChemNet > CAS > 25629-50-9 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
25629-50-9 3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride
| Nome del prodotto |
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
| Sinonimi |
3-(2-Chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride; 3-(o-Chlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride; CMIC Chloride |
| Formula molecolare |
C11H7Cl2NO2 |
| Peso Molecolare |
256.0848 |
| InChI |
InChI=1/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
| Numero CAS |
25629-50-9 |
| EINECS |
247-137-4 |
| Struttura molecolare |
|
| Densità |
1.381g/cm3 |
| Punto di ebollizione |
381.7°C at 760 mmHg |
| Indice di rifrazione |
1.574 |
| Punto d'infiammabilità |
184.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
