ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
| Nome del prodotto |
6-Aminochrysene |
| Sinonimi |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| Formula molecolare |
C18H13N |
| Peso Molecolare |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| Numero CAS |
2642-98-0 |
| EINECS |
220-149-7 |
| Struttura molecolare |
|
| Densità |
1.253g/cm3 |
| Punto di fusione |
206-211℃ |
| Punto di ebollizione |
501.2°C at 760 mmHg |
| Indice di rifrazione |
1.813 |
| Punto d'infiammabilità |
286.9°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
