ChemNet > CAS > 2777-65-3 10-Undecynoic acid
2777-65-3 10-Undecynoic acid
| Nome del prodotto |
10-Undecynoic acid |
| Formula molecolare |
C11H18O2 |
| Peso Molecolare |
182.2594 |
| InChI |
InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| Numero CAS |
2777-65-3 |
| EINECS |
220-471-8 |
| Struttura molecolare |
|
| Densità |
0.966g/cm3 |
| Punto di ebollizione |
297.7°C at 760 mmHg |
| Indice di rifrazione |
1.468 |
| Punto d'infiammabilità |
142.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
