2778-96-3 stearyl stearate
Nome del prodotto |
stearyl stearate |
Nome inglese |
stearyl stearate; stearic acid stearyl ester; octadecyl octadecanoate |
Formula molecolare |
C36H72O2 |
Peso Molecolare |
536.9557 |
InChI |
InChI=1/C36H72O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-36(37)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-35H2,1-2H3 |
Numero CAS |
2778-96-3 |
EINECS |
220-476-5 |
Struttura molecolare |
|
Densità |
0.857g/cm3 |
Punto di ebollizione |
549.1°C at 760 mmHg |
Indice di rifrazione |
1.457 |
Punto d'infiammabilità |
297°C |
Pressione di vapore |
4.14E-12mmHg at 25°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|