ChemNet > CAS > 30934-97-5 Glycolaldehyde dimethyl acetal
30934-97-5 Glycolaldehyde dimethyl acetal
| Nome del prodotto |
Glycolaldehyde dimethyl acetal |
| Sinonimi |
2,2-Dimethoxyethanol~Hydroxyacetaldehyde dimethyl acetal; 2,2-Dimethoxyethanol; 2,3-dimethoxy ethanol |
| Formula molecolare |
C4H10O3 |
| Peso Molecolare |
106.1204 |
| InChI |
InChI=1/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
| Numero CAS |
30934-97-5 |
| EINECS |
250-398-7 |
| Struttura molecolare |
|
| Densità |
1.009g/cm3 |
| Punto di ebollizione |
146.1°C at 760 mmHg |
| Indice di rifrazione |
1.401 |
| Punto d'infiammabilità |
42.2°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
