ChemNet > CAS > 31545-26-3 4-cloro-3-nitrofenilciclopropilchetone
31545-26-3 4-cloro-3-nitrofenilciclopropilchetone
| Nome del prodotto |
4-cloro-3-nitrofenilciclopropilchetone |
| Sinonimi |
(4-cloro-3-nitrofenile) (ciclopropil)metano |
| Nome inglese |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| Formula molecolare |
C10H8ClNO3 |
| Peso Molecolare |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| Numero CAS |
31545-26-3 |
| EINECS |
250-690-4 |
| Struttura molecolare |
|
| Densità |
1.464g/cm3 |
| Punto di fusione |
78-80℃ |
| Punto di ebollizione |
333.4°C at 760 mmHg |
| Indice di rifrazione |
1.631 |
| Punto d'infiammabilità |
155.4°C |
| Pressione di vapore |
0.000137mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|