ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
| Nome del prodotto |
dipropylene glycol monomethyl ether, mixture of isomers |
| Nome inglese |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
| Formula molecolare |
C7H16O3 |
| Peso Molecolare |
148.2001 |
| InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
| Numero CAS |
34590-94-8 |
| EINECS |
252-104-2 |
| Struttura molecolare |
|
| Densità |
0.958g/cm3 |
| Punto di ebollizione |
155.6°C at 760 mmHg |
| Indice di rifrazione |
1.423 |
| Punto d'infiammabilità |
47.9°C |
| Pressione di vapore |
1.09mmHg at 25°C |
| Sicurezza Descrizione |
S23:;
S24/25:;
|
|