ChemNet > CAS > 35213-00-4 2,6-Dinitrobenzonitrile
35213-00-4 2,6-Dinitrobenzonitrile
| Nome del prodotto |
2,6-Dinitrobenzonitrile |
| Sinonimi |
Dinitrobenzonitrile; Benzonitrile, 2,6-dinitro-; 2,3-dinitrobenzonitrile |
| Formula molecolare |
C7H3N3O4 |
| Peso Molecolare |
193.1164 |
| InChI |
InChI=1/C7H3N3O4/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14/h1-3H |
| Numero CAS |
35213-00-4 |
| Struttura molecolare |
|
| Densità |
1.555g/cm3 |
| Punto di ebollizione |
387.959°C at 760 mmHg |
| Indice di rifrazione |
1.616 |
| Punto d'infiammabilità |
188.431°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
