ChemNet > CAS > 3550-21-8 Benzhydryl isothiocyanate
3550-21-8 Benzhydryl isothiocyanate
| Nome del prodotto |
Benzhydryl isothiocyanate |
| Nome inglese |
Benzhydryl isothiocyanate; Diphenylmethyl isothiocyanate; 1,1'-(isothiocyanatomethanediyl)dibenzene |
| Formula molecolare |
C14H11NS |
| Peso Molecolare |
225.3088 |
| InChI |
InChI=1/C14H11NS/c16-11-15-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H |
| Numero CAS |
3550-21-8 |
| Struttura molecolare |
|
| Densità |
1.05g/cm3 |
| Punto di fusione |
58℃ |
| Punto di ebollizione |
333.3°C at 760 mmHg |
| Indice di rifrazione |
1.59 |
| Punto d'infiammabilità |
163°C |
| Pressione di vapore |
0.000266mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|