ChemNet > CAS > 37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
| Nome del prodotto |
Methyl 1-methylpyrrole-2-carboxylate |
| Sinonimi |
1-Methylpyrrole-2-carboxylic acid methyl ester; methyl 1-methyl-1H-pyrrole-2-carboxylate |
| Formula molecolare |
C7H9NO2 |
| Peso Molecolare |
139.1519 |
| InChI |
InChI=1/C7H9NO2/c1-8-5-3-4-6(8)7(9)10-2/h3-5H,1-2H3 |
| Numero CAS |
37619-24-2 |
| Struttura molecolare |
|
| Densità |
1.07g/cm3 |
| Punto di ebollizione |
204.7°C at 760 mmHg |
| Indice di rifrazione |
1.5 |
| Punto d'infiammabilità |
77.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
