ChemNet > CAS > 4476-28-2 4-Isopropylphenylacetic acid
4476-28-2 4-Isopropylphenylacetic acid
| Nome del prodotto |
4-Isopropylphenylacetic acid |
| Sinonimi |
AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
| Formula molecolare |
C11H13O2 |
| Peso Molecolare |
177.2203 |
| InChI |
InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| Numero CAS |
4476-28-2 |
| EINECS |
224-755-2 |
| Struttura molecolare |
|
| Punto di ebollizione |
295°C at 760 mmHg |
| Punto d'infiammabilità |
192.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
