515-00-4 (-)-Myrtenol
| Nome del prodotto |
(-)-Myrtenol |
| Nome inglese |
(-)-Myrtenol; (-)-pin-2-ene-10-ol; (6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methanol |
| Formula molecolare |
C10H16O |
| Peso Molecolare |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3 |
| Numero CAS |
515-00-4 |
| EINECS |
208-193-5 |
| Struttura molecolare |
|
| Densità |
0.991g/cm3 |
| Punto di ebollizione |
224.8°C at 760 mmHg |
| Indice di rifrazione |
1.504 |
| Punto d'infiammabilità |
89.4°C |
| Pressione di vapore |
0.0179mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|