72-18-4;7004-03-7 L-Valine
Nome del prodotto |
L-Valine |
Nome inglese |
L-Valine; L-2-Amino-3-methylbutyric acid; L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade; H-Val-OH; 2-Amino-3-methylbutanoic acid; Lvaline; L-2-Aminoisovaleric acid; (S)-(+)-2-Amino-3-methylbutyric acid; ; 1-2-Amino-3-methylbutyric acid; Valine |
Formula molecolare |
C5H11NO2 |
Peso Molecolare |
117.1478 |
InChI |
InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
Numero CAS |
72-18-4;7004-03-7 |
EINECS |
200-773-6 |
Struttura molecolare |
|
Punto di fusione |
315℃ |
Indice di rifrazione |
1.507 |
Solubilità in acqua |
85 g/L (20℃) |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|