99-20-7 D-Trehalose anhydrous
| Nome del prodotto |
D-Trehalose anhydrous |
| Nome inglese |
D-Trehalose anhydrous; Trehalose; alpha-D-Trehalose; alpha-D-glucopyranosyl alpha-D-glucopyranoside; Trehalose; D(+)Trehalose; D-(+)-Trehalose; α-L-glucopyranosyl; α-D-glucopyranoside; Trehalose anhydrous |
| Formula molecolare |
C12H22O11 |
| Peso Molecolare |
342.2965 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| Numero CAS |
99-20-7 |
| EINECS |
202-739-6 |
| Struttura molecolare |
|
| Densità |
1.76g/cm3 |
| Punto di fusione |
214-216℃ |
| Punto di ebollizione |
675.4°C at 760 mmHg |
| Indice di rifrazione |
1.652 |
| Punto d'infiammabilità |
362.3°C |
| Pressione di vapore |
3.87E-21mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|