ChemNet > CAS > 102170-56-9 2-Bromo-6-methyl-4-nitroaniline
102170-56-9 2-Bromo-6-methyl-4-nitroaniline
상품명칭 |
2-Bromo-6-methyl-4-nitroaniline |
분자식 |
C7H7BrN2O2 |
분자량 |
231.0467 |
InChI |
InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
cas번호 |
102170-56-9 |
분자 구조 |
|
밀도 |
1.698g/cm3 |
녹는 점 |
177-181℃ |
비등점 |
366°C at 760 mmHg |
굴절 지수 |
1.648 |
인화점 |
175.2°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|