103-30-0 trans-Stilbene
상품명칭 |
trans-Stilbene |
영문 이름 |
trans-Stilbene; trans-1,1-(1,2-Ethenediyl)bis(benzene); 1,1'-ethene-1,1-diyldibenzene; 1,1'-(E)-ethene-1,2-diyldibenzene; 1,1'-(Z)-ethene-1,2-diyldibenzene |
분자식 |
C14H12 |
분자량 |
180.2451 |
InChI |
InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
cas번호 |
103-30-0 |
EC번호 |
203-098-5 |
분자 구조 |
|
밀도 |
1.044g/cm3 |
녹는 점 |
122-126℃ |
비등점 |
307°C at 760 mmHg |
굴절 지수 |
1.658 |
인화점 |
128.5°C |
증기압 |
0.00135mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|