ChemNet > CAS > 105-61-3 N-Carbamoylmaleamic acid
105-61-3 N-Carbamoylmaleamic acid
상품명칭 |
N-Carbamoylmaleamic acid |
별명 |
Maleuric acid; Maleic acid monoureide~Maleuric acid; (2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid; (2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid; 4-(carbamoylamino)-4-oxobut-2-enoate |
분자식 |
C5H5N2O4 |
분자량 |
157.1047 |
InChI |
InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
cas번호 |
105-61-3 |
EC번호 |
203-314-8 |
분자 구조 |
|
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|