The physical and chemical property of 106-26-3 is provided by ChemNet.com
Chemical CAS Database with Global Chemical Suppliers - ChemNet


   ChemNet > CAS > 106-26-3 시스-시트랄 = 네랄 = 시스-3,7-디메틸-옥타-2,6-디엔-1-알

106-26-3 시스-시트랄 = 네랄 = 시스-3,7-디메틸-옥타-2,6-디엔-1-알

상품명칭 시스-시트랄 = 네랄 = 시스-3,7-디메틸-옥타-2,6-디엔-1-알
별명 ; 2,6-옥타디엔날, 3,7-디메틸-, (2Z)-; (Z)-시트랄; (Z)-네랄; AI3-28518; 시트랄 b; UNII-8M466BQL1X; 베타-시트랄; 시스-3,7-디메틸-2,6-옥타디에날; 시스-시트랄; (Z)-3,7-디메틸옥타-2,6-디에날; 2,6-옥타디엔날, 3,7-디메틸-, (Z)-; (2Z)-3,7-디메틸옥타-2,6-디에날
영문 이름 cis-Citral = Neral = cis-3,7-Dimethyl-octa-2,6-dien-1-al; 2,6-Octadienal, 3,7-dimethyl-, (2Z)-; (Z)-Citral; (Z)-Neral; AI3-28518; Citral b; UNII-8M466BQL1X; beta-Citral; cis-3,7-Dimethyl-2,6-octadienal; cis-Citral; (Z)-3,7-Dimethylocta-2,6-dienal; 2,6-Octadienal, 3,7-dimethyl-, (Z)-; (2Z)-3,7-dimethylocta-2,6-dienal
분자식 C10H16O
분자량 152.2334
InChI InChI=1/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7-
cas번호 106-26-3
EC번호 203-379-2
분자 구조 106-26-3 시스-시트랄 = 네랄 = 시스-3,7-디메틸-옥타-2,6-디엔-1-알
밀도 0.856g/cm3
비등점 229°C at 760 mmHg
굴절 지수 1.456
인화점 101.7°C
증기압 0.0712mmHg at 25°C