ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
| 상품명칭 |
ethyl (R)-(-)-mandelate |
| 별명 |
(-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
| 분자식 |
C10H12O3 |
| 분자량 |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| cas번호 |
10606-72-1 |
| 분자 구조 |
|
| 밀도 |
1.147g/cm3 |
| 녹는 점 |
33-34℃ |
| 비등점 |
254°C at 760 mmHg |
| 굴절 지수 |
1.528 |
| 인화점 |
118.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
