107-84-6 1-Chloro-3-methylbutane
상품명칭 |
1-Chloro-3-methylbutane |
영문 이름 |
1-Chloro-3-methylbutane; Isoamyl chloride~Isopentyl chloride |
분자식 |
C5H11Cl |
분자량 |
106.5938 |
InChI |
InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
cas번호 |
107-84-6 |
EC번호 |
203-525-5 |
분자 구조 |
|
밀도 |
0.867g/cm3 |
비등점 |
98.3°C at 760 mmHg |
굴절 지수 |
1.403 |
인화점 |
9.8°C |
증기압 |
46.2mmHg at 25°C |
리스크 규칙 |
R11:Highly flammable.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|