ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
상품명칭 |
Triethyleneglycoldiacetate |
별명 |
Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
분자식 |
C10H18O6 |
분자량 |
234.2463 |
InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
cas번호 |
111-21-7 |
EC번호 |
203-846-0 |
분자 구조 |
|
밀도 |
1.098g/cm3 |
비등점 |
286°C at 760 mmHg |
굴절 지수 |
1.432 |
인화점 |
125.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|