ChemNet > CAS > 1122-97-0 4-(Methylthio)thiophenol
1122-97-0 4-(Methylthio)thiophenol
상품명칭 |
4-(Methylthio)thiophenol |
별명 |
4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol |
분자식 |
C7H8S2 |
분자량 |
156.2684 |
InChI |
InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
cas번호 |
1122-97-0 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
비등점 |
252.9°C at 760 mmHg |
굴절 지수 |
1.621 |
인화점 |
106.7°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|