ChemNet > CAS > 112399-50-5 2-Bromo-5-fluorobenzyl bromide
112399-50-5 2-Bromo-5-fluorobenzyl bromide
| 상품명칭 |
2-Bromo-5-fluorobenzyl bromide |
| 영문 이름 |
2-Bromo-5-fluorobenzyl bromide; 2-Bromo-5-fluorobenzylbromide; 1-bromo-2-(bromomethyl)-4-fluorobenzene; 5-Fluoro-2-Bromobenzyl Bromide |
| 분자식 |
C7H5Br2F |
| 분자량 |
267.921 |
| InChI |
InChI=1/C7H5Br2F/c8-4-5-3-6(10)1-2-7(5)9/h1-3H,4H2 |
| cas번호 |
112399-50-5 |
| 분자 구조 |
|
| 밀도 |
1.923g/cm3 |
| 비등점 |
245.4°C at 760 mmHg |
| 굴절 지수 |
1.583 |
| 인화점 |
102.2°C |
| 증기압 |
0.045mmHg at 25°C |
| 리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|