ChemNet > CAS > 1124-04-5 2-chloro-4,5-dimethylphenol
1124-04-5 2-chloro-4,5-dimethylphenol
상품명칭 |
2-chloro-4,5-dimethylphenol |
영문 이름 |
2-chloro-4,5-dimethylphenol; 6-Chloro-3,4-xylenol (OH=1); 6-Chloro-3,4-xylenol |
분자식 |
C8H9ClO |
분자량 |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,1-2H3 |
cas번호 |
1124-04-5 |
EC번호 |
214-386-5 |
분자 구조 |
|
밀도 |
1.183g/cm3 |
녹는 점 |
70-72℃ |
비등점 |
237°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
97.1°C |
증기압 |
0.03mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|