ChemNet > CAS > 1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
| 상품명칭 |
isopropyl 3,4,5-trihydroxybenzoate |
| 영문 이름 |
isopropyl 3,4,5-trihydroxybenzoate; Isopropyl gallate; Gallic acid isopropyl ester; propan-2-yl 3,4,5-trihydroxybenzoate; Isopropylgallate |
| 분자식 |
C10H12O5 |
| 분자량 |
212.1993 |
| InChI |
InChI=1/C10H12O5/c1-5(2)15-10(14)6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,1-2H3 |
| cas번호 |
1138-60-9 |
| EC번호 |
214-515-5 |
| 분자 구조 |
|
| 밀도 |
1.36g/cm3 |
| 비등점 |
439.5°C at 760 mmHg |
| 굴절 지수 |
1.593 |
| 인화점 |
177.4°C |
| 증기압 |
2.47E-08mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|