ChemNet > CAS > 114636-31-6 (3S)-(-)-3-Acetamidopyrrolidine
114636-31-6 (3S)-(-)-3-Acetamidopyrrolidine
상품명칭 |
(3S)-(-)-3-Acetamidopyrrolidine |
별명 |
N-[(3R)-pyrrolidin-3-yl]acetamide; N-[(3S)-pyrrolidin-3-yl]acetamide |
분자식 |
C6H12N2O |
분자량 |
128.1723 |
InChI |
InChI=1/C6H12N2O/c1-5(9)8-6-2-3-7-4-6/h6-7H,2-4H2,1H3,(H,8,9)/t6-/m0/s1 |
cas번호 |
114636-31-6 |
분자 구조 |
|
밀도 |
1.04g/cm3 |
비등점 |
306.8°C at 760 mmHg |
굴절 지수 |
1.485 |
인화점 |
150.8°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|