ChemNet > CAS > 1195-92-2 (+)-Limonene oxide, mixture of cis and trans
1195-92-2 (+)-Limonene oxide, mixture of cis and trans
| 상품명칭 |
(+)-Limonene oxide, mixture of cis and trans |
| 별명 |
Limonene-1,2-epoxide; 1,2-Epoxy-p-menth-8-ene; 1,2-Epoxylimonene; 1-Methyl-4-(1-methylethenyl)-7-oxabicyclo(4.1.0)heptane; AI3-24998; CCRIS 3763; Limonene 1,2-epoxide; Limonene 1,2-oxide; Limonene epoxide; Limonene monoxide; Limonene oxide; NSC 12045; (+)-Limonene oxide; 1-Methyl-4-(1-methylvinyl)-7-oxabicyclo(4.1.0)heptane; 7-Oxabicyclo(4.1.0)heptane, 1-methyl-4-(1-methylethenyl)-; p-Menth-8-ene, 1,2-epoxy-; 1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane; (4R)-1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane; (1S,4R,6R)-1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane; (1S,4S,6R)-1-methyl-4-(1-methylethenyl)-7-oxabicyclo[4.1.0]heptane; (1R,4R,6S)-1-methyl-4-(1-methylethenyl)-7-oxabicyclo[4.1.0]heptane |
| 분자식 |
C10H16O |
| 분자량 |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| cas번호 |
1195-92-2 |
| EC번호 |
214-805-1 |
| 분자 구조 |
|
| 밀도 |
0.972g/cm3 |
| 비등점 |
198.1°C at 760 mmHg |
| 굴절 지수 |
1.49 |
| 인화점 |
65.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
