ChemNet > CAS > 119795-57-2 1-chloro-4-(3-iodopropoxy)benzene
119795-57-2 1-chloro-4-(3-iodopropoxy)benzene
상품명칭 |
1-chloro-4-(3-iodopropoxy)benzene |
영문 이름 |
1-chloro-4-(3-iodopropoxy)benzene; |
분자식 |
C9H10ClIO |
분자량 |
296.5326 |
InChI |
InChI=1/C9H10ClIO/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5H,1,6-7H2 |
cas번호 |
119795-57-2 |
분자 구조 |
|
밀도 |
1.673g/cm3 |
녹는 점 |
31℃ |
비등점 |
317°C at 760 mmHg |
굴절 지수 |
1.593 |
인화점 |
145.5°C |
증기압 |
0.000737mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|