120-61-6 Dimethyl terephthalate
상품명칭 |
Dimethyl terephthalate |
영문 이름 |
Dimethyl terephthalate; D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
분자식 |
C10H10O4 |
분자량 |
194.184 |
InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
cas번호 |
120-61-6 |
EC번호 |
204-411-8 |
분자 구조 |
|
밀도 |
1.175g/cm3 |
녹는 점 |
140-143℃ |
비등점 |
282.7°C at 760 mmHg |
굴절 지수 |
1.514 |
인화점 |
146.7°C |
증기압 |
0.00331mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|