ChemNet > CAS > 130723-54-5 3-Iodophenylacetonitrile
130723-54-5 3-Iodophenylacetonitrile
상품명칭 |
3-Iodophenylacetonitrile |
영문 이름 |
3-Iodophenylacetonitrile; 3-Iodobenzyl cyanide |
분자식 |
C8H6IN |
분자량 |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
cas번호 |
130723-54-5 |
분자 구조 |
|
밀도 |
1.764g/cm3 |
비등점 |
308.6°C at 760 mmHg |
굴절 지수 |
1.624 |
인화점 |
140.4°C |
증기압 |
0.000674mmHg at 25°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|