ChemNet > CAS > 13194-67-7 4-fluoro-2-iodotoluene
13194-67-7 4-fluoro-2-iodotoluene
상품명칭 |
4-fluoro-2-iodotoluene |
별명 |
4-Fluoro-2-iodo-1-methylbenzene |
분자식 |
C7H6FI |
분자량 |
236.0254 |
InChI |
InChI=1/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
cas번호 |
13194-67-7 |
EC번호 |
236-153-7 |
분자 구조 |
|
밀도 |
1.788g/cm3 |
비등점 |
205.1°C at 760 mmHg |
굴절 지수 |
1.58 |
인화점 |
81°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|