ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
| 상품명칭 |
4-iodo-2-methylaniline |
| 별명 |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
| 분자식 |
C7H8IN |
| 분자량 |
233.0496 |
| InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| cas번호 |
13194-68-8 |
| EC번호 |
236-154-2 |
| 분자 구조 |
|
| 밀도 |
1.791g/cm3 |
| 녹는 점 |
86-89℃ |
| 비등점 |
278.4°C at 760 mmHg |
| 굴절 지수 |
1.663 |
| 인화점 |
122.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
