ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
상품명칭 |
4-iodo-2-methylaniline |
별명 |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
분자식 |
C7H8IN |
분자량 |
233.0496 |
InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
cas번호 |
13194-68-8 |
EC번호 |
236-154-2 |
분자 구조 |
|
밀도 |
1.791g/cm3 |
녹는 점 |
86-89℃ |
비등점 |
278.4°C at 760 mmHg |
굴절 지수 |
1.663 |
인화점 |
122.1°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|