ChemNet > CAS > 13265-84-4 D-glucal
13265-84-4 D-glucal
상품명칭 |
D-glucal |
별명 |
1,5-Anhydro-2-deoxy-D-arabino-hex-1-enitol; D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-; (4xi)-1,5-anhydro-2-deoxy-D-threo-hex-1-enitol |
분자식 |
C6H10O4 |
분자량 |
146.1412 |
InChI |
InChI=1/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6+/m1/s1 |
cas번호 |
13265-84-4 |
EC번호 |
236-259-3 |
분자 구조 |
|
밀도 |
1.414g/cm3 |
녹는 점 |
58-60℃ |
비등점 |
325.5°C at 760 mmHg |
굴절 지수 |
1.565 |
인화점 |
150.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|