ChemNet > CAS > 13788-84-6 3-Methyl-4-phenylpyrazole
13788-84-6 3-Methyl-4-phenylpyrazole
상품명칭 |
3-Methyl-4-phenylpyrazole |
영문 이름 |
3-Methyl-4-phenylpyrazole;3-Methyl-4-phenylpyrazol; 3-methyl-4-phenyl-1H-pyrazole |
분자식 |
C10H10N2 |
분자량 |
158.1998 |
InChI |
InChI=1/C10H10N2/c1-8-10(7-11-12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
cas번호 |
13788-84-6 |
분자 구조 |
|
밀도 |
1.109g/cm3 |
녹는 점 |
142-144℃ |
비등점 |
321.2°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
148.4°C |
증기압 |
0.000568mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|