14309-57-0 3-Nonen-2-one
상품명칭 |
3-Nonen-2-one |
영문 이름 |
3-Nonen-2-one;non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
분자식 |
C9H16O |
분자량 |
140.2227 |
InChI |
InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
cas번호 |
14309-57-0 |
EC번호 |
238-248-9 |
분자 구조 |
|
밀도 |
0.835g/cm3 |
비등점 |
201.9°C at 760 mmHg |
굴절 지수 |
1.435 |
인화점 |
81.3°C |
증기압 |
0.301mmHg at 25°C |
리스크 규칙 |
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|