ChemNet > CAS > 145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
상품명칭 |
Methyl 2,5-dichlorothiophene-3-carboxylate |
별명 |
2,5-Dichlorothiophene-3-carboxylic acid methyl ester |
분자식 |
C6H4Cl2O2S |
분자량 |
211.0658 |
InChI |
InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3 |
cas번호 |
145129-54-0 |
분자 구조 |
|
밀도 |
1.5g/cm3 |
비등점 |
257.3°C at 760 mmHg |
굴절 지수 |
1.57 |
인화점 |
109.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|