ChemNet > CAS > 1483-72-3 Diphenyliodonium chloride
1483-72-3 Diphenyliodonium chloride
상품명칭 |
Diphenyliodonium chloride |
별명 |
Iodonium, diphenyl-, chloride (1:1); AI3-17092; NSC 134275; Iodonium, diphenyl-, chloride |
분자식 |
C12H10I |
분자량 |
281.11227 |
InChI |
InChI=1/C12H10I/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/q-1 |
cas번호 |
1483-72-3 |
EC번호 |
216-049-8 |
분자 구조 |
|
녹는 점 |
227-235℃ |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S37/39:Wear suitable gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|