ChemNet > CAS > 15088-78-5 Phenylacetyl Disulphide
15088-78-5 Phenylacetyl Disulphide
| 상품명칭 |
Phenylacetyl Disulphide |
| 별명 |
Phenylacetyl Disulfide; Bis(phenylacetyl) disulphide; PADS; Phenylacetyldisulfide; dibenzyldithioperoxyanhydride |
| 분자식 |
C16H14O2S2 |
| 분자량 |
302.4112 |
| InChI |
InChI=1/C16H14O2S2/c17-15(11-13-7-3-1-4-8-13)19-20-16(18)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| cas번호 |
15088-78-5 |
| 분자 구조 |
|
| 밀도 |
1.269g/cm3 |
| 녹는 점 |
59-63℃ |
| 비등점 |
481.1°C at 760 mmHg |
| 굴절 지수 |
1.638 |
| 인화점 |
210.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
