ChemNet > CAS > 1551-44-6 cyclohexyl butyrate
1551-44-6 cyclohexyl butyrate
상품명칭 |
cyclohexyl butyrate |
별명 |
Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
분자식 |
C10H18O2 |
분자량 |
170.2487 |
InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
cas번호 |
1551-44-6 |
EC번호 |
216-290-9 |
분자 구조 |
|
밀도 |
0.94g/cm3 |
비등점 |
214.9°C at 760 mmHg |
굴절 지수 |
1.449 |
인화점 |
78°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|