1556-18-9 Iodocyclopentane
상품명칭 |
Iodocyclopentane |
영문 이름 |
Iodocyclopentane; Iodocyclopentane (Cyclopentyl iodide); Cyclopentyl iodide; 1-isothiocyanato-3-methoxybenzene |
분자식 |
C8H7NOS |
분자량 |
165.2123 |
InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
cas번호 |
1556-18-9 |
EC번호 |
216-311-1 |
분자 구조 |
|
밀도 |
1.08g/cm3 |
비등점 |
280.5°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
123.4°C |
증기압 |
0.00642mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|