ChemNet > CAS > 1575-74-2 2-Methylpent-4-enoic acid
1575-74-2 2-Methylpent-4-enoic acid
| 상품명칭 |
2-Methylpent-4-enoic acid |
| 별명 |
2-Methyl-4-pentenoic acid; (2S)-2-methylpent-4-enoate; (2R)-2-methylpent-4-enoate |
| 분자식 |
C6H9O2 |
| 분자량 |
113.135 |
| InChI |
InChI=1/C6H10O2/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3,(H,7,8)/p-1/t5-/m1/s1 |
| cas번호 |
1575-74-2 |
| EC번호 |
216-404-7 |
| 분자 구조 |
|
| 비등점 |
190.6°C at 760 mmHg |
| 인화점 |
88.1°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
